C21H23N5O5 — CID 155282679
tert-butyl N-amino-N-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]carbamate (PubChem CID 155282679) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is tert-butyl N-amino-N-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]carbamate.
| Compound Name | tert-butyl N-amino-N-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]carbamate |
|---|---|
| PubChem CID | 155282679 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | tert-butyl N-amino-N-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)N(N)NC(=O)N(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H23N5O5/c1-21(2,3)31-20(30)26(22)23-19(29)24(13-14-9-5-4-6-10-14)25-17(27)15-11-7-8-12-16(15)18(25)28/h4-12H,13,22H2,1-3H3,(H,23,29) |
| InChIKey | MTMXAQKNMOVXSY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|