C28H27N3O5 — CID 155720631
methyl (2S)-2-[[(1,3-dioxoisoindol-2-yl)-[(2-ethylphenyl)methyl]carbamoyl]amino]-3-phenylpropanoate (PubChem CID 155720631) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is methyl (2S)-2-[[(1,3-dioxoisoindol-2-yl)-[(2-ethylphenyl)methyl]carbamoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(1,3-dioxoisoindol-2-yl)-[(2-ethylphenyl)methyl]carbamoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 155720631 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | methyl (2S)-2-[[(1,3-dioxoisoindol-2-yl)-[(2-ethylphenyl)methyl]carbamoyl]amino]-3-phenylpropanoate |
| SMILES | CCc1ccccc1CN(C(=O)N[C@@H](Cc1ccccc1)C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H27N3O5/c1-3-20-13-7-8-14-21(20)18-30(31-25(32)22-15-9-10-16-23(22)26(31)33)28(35)29-24(27(34)36-2)17-19-11-5-4-6-12-19/h4-16,24H,3,17-18H2,1-2H3,(H,29,35)/t24-/m0/s1 |
| InChIKey | CNSKLKBCHFXWES-DEOSSOPVSA-N |
| XLogP | 3.76 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|