C29H30N6O5 — CID 155281305
methyl 5-[[amino(anilino)methylidene]amino]-2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]pentanoate (PubChem CID 155281305) has the molecular formula C29H30N6O5 and a molecular weight of 542.60 g/mol. Its IUPAC name is methyl 5-[[amino(anilino)methylidene]amino]-2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]pentanoate.
| Compound Name | methyl 5-[[amino(anilino)methylidene]amino]-2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]pentanoate |
|---|---|
| PubChem CID | 155281305 |
| Molecular Formula | C29H30N6O5 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | methyl 5-[[amino(anilino)methylidene]amino]-2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]pentanoate |
| SMILES | COC(=O)C(CCC/N=C(\N)Nc1ccccc1)NC(=O)N(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H30N6O5/c1-40-27(38)24(17-10-18-31-28(30)32-21-13-6-3-7-14-21)33-29(39)34(19-20-11-4-2-5-12-20)35-25(36)22-15-8-9-16-23(22)26(35)37/h2-9,11-16,24H,10,17-19H2,1H3,(H,33,39)(H3,30,31,32) |
| InChIKey | LOEIWAUYJPQQMS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|