C29H25N3O5 — CID 160524535
methyl (2S)-2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]-3-(3H-inden-1-yl)propanoate (PubChem CID 160524535) has the molecular formula C29H25N3O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is methyl (2S)-2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]-3-(3H-inden-1-yl)propanoate.
| Compound Name | methyl (2S)-2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]-3-(3H-inden-1-yl)propanoate |
|---|---|
| PubChem CID | 160524535 |
| Molecular Formula | C29H25N3O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | methyl (2S)-2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]-3-(3H-inden-1-yl)propanoate |
| SMILES | COC(=O)[C@H](CC1=CCc2ccccc21)NC(=O)N(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H25N3O5/c1-37-28(35)25(17-21-16-15-20-11-5-6-12-22(20)21)30-29(36)31(18-19-9-3-2-4-10-19)32-26(33)23-13-7-8-14-24(23)27(32)34/h2-14,16,25H,15,17-18H2,1H3,(H,30,36)/t25-/m0/s1 |
| InChIKey | QUSGJWVDIOIGFL-VWLOTQADSA-N |
| XLogP | 3.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|