C13H15NO2 — CID 58249638
methyl (2R)-2-amino-3-(3H-inden-1-yl)propanoate (PubChem CID 58249638) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-(3H-inden-1-yl)propanoate.
| Compound Name | methyl (2R)-2-amino-3-(3H-inden-1-yl)propanoate |
|---|---|
| PubChem CID | 58249638 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | methyl (2R)-2-amino-3-(3H-inden-1-yl)propanoate |
| SMILES | COC(=O)[C@H](N)CC1=CCc2ccccc21 |
| InChI | InChI=1S/C13H15NO2/c1-16-13(15)12(14)8-10-7-6-9-4-2-3-5-11(9)10/h2-5,7,12H,6,8,14H2,1H3/t12-/m1/s1 |
| InChIKey | YMCDJTJXWNMKIK-GFCCVEGCSA-N |
| XLogP | 1.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |