C22H21N3O5 — CID 155279562
methyl (2S)-1-[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]pyrrolidine-2-carboxylate (PubChem CID 155279562) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl (2S)-1-[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 155279562 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl (2S)-1-[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)N(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H21N3O5/c1-30-21(28)18-12-7-13-23(18)22(29)24(14-15-8-3-2-4-9-15)25-19(26)16-10-5-6-11-17(16)20(25)27/h2-6,8-11,18H,7,12-14H2,1H3/t18-/m0/s1 |
| InChIKey | KLDFEJHWTGLUDJ-SFHVURJKSA-N |
| XLogP | 2.46 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|