C16H22N2O3 — CID 59546408
methyl (2S)-1-[ethyl(phenyl)carbamoyl]piperidine-2-carboxylate (PubChem CID 59546408) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl (2S)-1-[ethyl(phenyl)carbamoyl]piperidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[ethyl(phenyl)carbamoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 59546408 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl (2S)-1-[ethyl(phenyl)carbamoyl]piperidine-2-carboxylate |
| SMILES | CCN(C(=O)N1CCCC[C@H]1C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O3/c1-3-17(13-9-5-4-6-10-13)16(20)18-12-8-7-11-14(18)15(19)21-2/h4-6,9-10,14H,3,7-8,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | GGSHIDBVFNGHEC-AWEZNQCLSA-N |
| XLogP | 2.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |