C22H20N2O7 — CID 165366864
(3S)-3-(1,3-dioxoisoindol-2-yl)-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 165366864) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is (3S)-3-(1,3-dioxoisoindol-2-yl)-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-(1,3-dioxoisoindol-2-yl)-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 165366864 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (3S)-3-(1,3-dioxoisoindol-2-yl)-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H20N2O7/c1-31-22(30)16(11-13-7-3-2-4-8-13)23-19(27)17(12-18(25)26)24-20(28)14-9-5-6-10-15(14)21(24)29/h2-10,16-17H,11-12H2,1H3,(H,23,27)(H,25,26)/t16-,17-/m0/s1 |
| InChIKey | OVMOLBFPBODLBT-IRXDYDNUSA-N |
| XLogP | 1.03 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|