C23H24N2O6 — CID 70273266
(2R)-2-[[2-(1,3-dioxoisoindol-2-yl)-6-hydroxyhexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 70273266) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is (2R)-2-[[2-(1,3-dioxoisoindol-2-yl)-6-hydroxyhexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[2-(1,3-dioxoisoindol-2-yl)-6-hydroxyhexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70273266 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (2R)-2-[[2-(1,3-dioxoisoindol-2-yl)-6-hydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)C(CCCCO)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H24N2O6/c26-13-7-6-12-19(25-21(28)16-10-4-5-11-17(16)22(25)29)20(27)24-18(23(30)31)14-15-8-2-1-3-9-15/h1-5,8-11,18-19,26H,6-7,12-14H2,(H,24,27)(H,30,31)/t18-,19?/m1/s1 |
| InChIKey | MMSYVNBOIIRMEO-MRTLOADZSA-N |
| XLogP | 1.63 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|