C21H23N3O6S — CID 54308672
(2S)-2-[[(2S)-2-[(1,3-dioxoisoindol-2-yl)amino]-3-thiophen-2-ylpropanoyl]amino]-6-hydroxyhexanoic acid (PubChem CID 54308672) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(1,3-dioxoisoindol-2-yl)amino]-3-thiophen-2-ylpropanoyl]amino]-6-hydroxyhexanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(1,3-dioxoisoindol-2-yl)amino]-3-thiophen-2-ylpropanoyl]amino]-6-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 54308672 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(1,3-dioxoisoindol-2-yl)amino]-3-thiophen-2-ylpropanoyl]amino]-6-hydroxyhexanoic acid |
| SMILES | O=C(O)[C@H](CCCCO)NC(=O)[C@H](Cc1cccs1)NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H23N3O6S/c25-10-4-3-9-16(21(29)30)22-18(26)17(12-13-6-5-11-31-13)23-24-19(27)14-7-1-2-8-15(14)20(24)28/h1-2,5-8,11,16-17,23,25H,3-4,9-10,12H2,(H,22,26)(H,29,30)/t16-,17-/m0/s1 |
| InChIKey | SJIHWCXQMVBBCQ-IRXDYDNUSA-N |
| XLogP | 1.19 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|