C21H28N2O8 — CID 131720213
methyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoyl]amino]-6,6-dimethoxyhexanoate (PubChem CID 131720213) has the molecular formula C21H28N2O8 and a molecular weight of 436.46 g/mol. Its IUPAC name is methyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoyl]amino]-6,6-dimethoxyhexanoate.
| Compound Name | methyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoyl]amino]-6,6-dimethoxyhexanoate |
|---|---|
| PubChem CID | 131720213 |
| Molecular Formula | C21H28N2O8 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | methyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoyl]amino]-6,6-dimethoxyhexanoate |
| SMILES | COC(=O)C(CCCC(OC)OC)NC(=O)C(CCO)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H28N2O8/c1-29-17(30-2)10-6-9-15(21(28)31-3)22-18(25)16(11-12-24)23-19(26)13-7-4-5-8-14(13)20(23)27/h4-5,7-8,15-17,24H,6,9-12H2,1-3H3,(H,22,25) |
| InChIKey | RYKZVAGSIJZGJY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|