C16H16F3NO5 — CID 146517907
methyl 2-(1,3-dioxoisoindol-2-yl)-7,7,7-trifluoro-6-hydroxyheptanoate (PubChem CID 146517907) has the molecular formula C16H16F3NO5 and a molecular weight of 359.30 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-7,7,7-trifluoro-6-hydroxyheptanoate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)-7,7,7-trifluoro-6-hydroxyheptanoate |
|---|---|
| PubChem CID | 146517907 |
| Molecular Formula | C16H16F3NO5 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)-7,7,7-trifluoro-6-hydroxyheptanoate |
| SMILES | COC(=O)C(CCCC(O)C(F)(F)F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H16F3NO5/c1-25-15(24)11(7-4-8-12(21)16(17,18)19)20-13(22)9-5-2-3-6-10(9)14(20)23/h2-3,5-6,11-12,21H,4,7-8H2,1H3 |
| InChIKey | UVJICRUTUAICDX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|