C34H34N2O7 — CID 102517154
methyl (2S)-2-[[1-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxycyclohexanecarbonyl]amino]-3-phenylpropanoate (PubChem CID 102517154) has the molecular formula C34H34N2O7 and a molecular weight of 582.65 g/mol. Its IUPAC name is methyl (2S)-2-[[1-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxycyclohexanecarbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[1-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxycyclohexanecarbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102517154 |
| Molecular Formula | C34H34N2O7 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | methyl (2S)-2-[[1-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxycyclohexanecarbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)C1(OC(=O)[C@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)CCCCC1 |
| InChI | InChI=1S/C34H34N2O7/c1-42-31(39)27(21-23-13-5-2-6-14-23)35-33(41)34(19-11-4-12-20-34)43-32(40)28(22-24-15-7-3-8-16-24)36-29(37)25-17-9-10-18-26(25)30(36)38/h2-3,5-10,13-18,27-28H,4,11-12,19-22H2,1H3,(H,35,41)/t27-,28-/m0/s1 |
| InChIKey | BEHDQCYFJSKIDU-NSOVKSMOSA-N |
| XLogP | 4.04 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|