C22H23N3O5S — CID 155279531
methyl 2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 155279531) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is methyl 2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 155279531 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | methyl 2-[[benzyl-(1,3-dioxoisoindol-2-yl)carbamoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)N(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H23N3O5S/c1-30-21(28)18(12-13-31-2)23-22(29)24(14-15-8-4-3-5-9-15)25-19(26)16-10-6-7-11-17(16)20(25)27/h3-11,18H,12-14H2,1-2H3,(H,23,29) |
| InChIKey | CWQDWFSMGGEBHE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|