C22H26N4O5 — CID 101393806
methyl (2S)-5-[[amino(benzamido)methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 101393806) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is methyl (2S)-5-[[amino(benzamido)methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (2S)-5-[[amino(benzamido)methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 101393806 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | methyl (2S)-5-[[amino(benzamido)methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)[C@H](CCC/N=C(\N)NC(=O)c1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H26N4O5/c1-30-20(28)18(25-22(29)31-15-16-9-4-2-5-10-16)13-8-14-24-21(23)26-19(27)17-11-6-3-7-12-17/h2-7,9-12,18H,8,13-15H2,1H3,(H,25,29)(H3,23,24,26,27)/t18-/m0/s1 |
| InChIKey | ASWPYWMUVWIEPZ-SFHVURJKSA-N |
| XLogP | 1.98 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|