C24H32N4O4 — CID 102126436
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(1R,2S)-2-(2-pyrazol-1-ylphenyl)cyclopent-3-en-1-yl]carbamate (PubChem CID 102126436) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(1R,2S)-2-(2-pyrazol-1-ylphenyl)cyclopent-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(1R,2S)-2-(2-pyrazol-1-ylphenyl)cyclopent-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 102126436 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(1R,2S)-2-(2-pyrazol-1-ylphenyl)cyclopent-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)[C@@H]1CC=C[C@H]1c1ccccc1-n1cccn1 |
| InChI | InChI=1S/C24H32N4O4/c1-23(2,3)31-21(29)26-28(22(30)32-24(4,5)6)20-14-9-12-18(20)17-11-7-8-13-19(17)27-16-10-15-25-27/h7-13,15-16,18,20H,14H2,1-6H3,(H,26,29)/t18-,20+/m0/s1 |
| InChIKey | NVKDJMSQEHEPED-AZUAARDMSA-N |
| XLogP | 4.96 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|