C26H32N4O4 — CID 102141302
ethyl N-[(1R,5R)-2-cyclohexylidene-5-(2-pyrazol-1-ylphenyl)cyclopent-3-en-1-yl]-N-(ethoxycarbonylamino)carbamate (PubChem CID 102141302) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is ethyl N-[(1R,5R)-2-cyclohexylidene-5-(2-pyrazol-1-ylphenyl)cyclopent-3-en-1-yl]-N-(ethoxycarbonylamino)carbamate.
| Compound Name | ethyl N-[(1R,5R)-2-cyclohexylidene-5-(2-pyrazol-1-ylphenyl)cyclopent-3-en-1-yl]-N-(ethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 102141302 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | ethyl N-[(1R,5R)-2-cyclohexylidene-5-(2-pyrazol-1-ylphenyl)cyclopent-3-en-1-yl]-N-(ethoxycarbonylamino)carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)[C@H]1C(=C2CCCCC2)C=C[C@@H]1c1ccccc1-n1cccn1 |
| InChI | InChI=1S/C26H32N4O4/c1-3-33-25(31)28-30(26(32)34-4-2)24-20(19-11-6-5-7-12-19)15-16-22(24)21-13-8-9-14-23(21)29-18-10-17-27-29/h8-10,13-18,22,24H,3-7,11-12H2,1-2H3,(H,28,31)/t22-,24+/m1/s1 |
| InChIKey | GDEJZERHPVPBQQ-VWNXMTODSA-N |
| XLogP | 5.27 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|