C18H24N2O5 — CID 101427492
ethyl N-(ethoxycarbonylamino)-N-[(1S)-2-(2-methoxyphenyl)cyclopent-3-en-1-yl]carbamate (PubChem CID 101427492) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl N-(ethoxycarbonylamino)-N-[(1S)-2-(2-methoxyphenyl)cyclopent-3-en-1-yl]carbamate.
| Compound Name | ethyl N-(ethoxycarbonylamino)-N-[(1S)-2-(2-methoxyphenyl)cyclopent-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 101427492 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | ethyl N-(ethoxycarbonylamino)-N-[(1S)-2-(2-methoxyphenyl)cyclopent-3-en-1-yl]carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)[C@H]1CC=CC1c1ccccc1OC |
| InChI | InChI=1S/C18H24N2O5/c1-4-24-17(21)19-20(18(22)25-5-2)15-11-8-10-13(15)14-9-6-7-12-16(14)23-3/h6-10,12-13,15H,4-5,11H2,1-3H3,(H,19,21)/t13?,15-/m0/s1 |
| InChIKey | QZPXAPDPDDYIBZ-WUJWULDRSA-N |
| XLogP | 3.23 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|