C13H18N2O6 — CID 101228986
ethyl N-(ethoxycarbonylamino)-N-(4-hydroxy-3-methoxyphenyl)carbamate (PubChem CID 101228986) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is ethyl N-(ethoxycarbonylamino)-N-(4-hydroxy-3-methoxyphenyl)carbamate.
| Compound Name | ethyl N-(ethoxycarbonylamino)-N-(4-hydroxy-3-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 101228986 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | ethyl N-(ethoxycarbonylamino)-N-(4-hydroxy-3-methoxyphenyl)carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O6/c1-4-20-12(17)14-15(13(18)21-5-2)9-6-7-10(16)11(8-9)19-3/h6-8,16H,4-5H2,1-3H3,(H,14,17) |
| InChIKey | DTBCDGSMWBHLML-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|