C11H16N2O4 — CID 70034657
ethyl N-[2-hydroxy-5-methoxy-4-(methylamino)phenyl]carbamate (PubChem CID 70034657) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is ethyl N-[2-hydroxy-5-methoxy-4-(methylamino)phenyl]carbamate.
| Compound Name | ethyl N-[2-hydroxy-5-methoxy-4-(methylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 70034657 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | ethyl N-[2-hydroxy-5-methoxy-4-(methylamino)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(OC)c(NC)cc1O |
| InChI | InChI=1S/C11H16N2O4/c1-4-17-11(15)13-7-6-10(16-3)8(12-2)5-9(7)14/h5-6,12,14H,4H2,1-3H3,(H,13,15) |
| InChIKey | VEICSQCTDJARCJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|