C16H18N3O5+ — CID 18552108
methyl N-[2-hydroxy-5-methoxy-4-[(2-pyridin-1-ium-1-ylacetyl)amino]phenyl]carbamate (PubChem CID 18552108) has the molecular formula C16H18N3O5+ and a molecular weight of 332.34 g/mol. Its IUPAC name is methyl N-[2-hydroxy-5-methoxy-4-[(2-pyridin-1-ium-1-ylacetyl)amino]phenyl]carbamate.
| Compound Name | methyl N-[2-hydroxy-5-methoxy-4-[(2-pyridin-1-ium-1-ylacetyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 18552108 |
| Molecular Formula | C16H18N3O5+ |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | methyl N-[2-hydroxy-5-methoxy-4-[(2-pyridin-1-ium-1-ylacetyl)amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cc(OC)c(NC(=O)C[n+]2ccccc2)cc1O |
| InChI | InChI=1S/C16H17N3O5/c1-23-14-9-11(18-16(22)24-2)13(20)8-12(14)17-15(21)10-19-6-4-3-5-7-19/h3-9H,10H2,1-2H3,(H2-,17,18,20,21,22)/p+1 |
| InChIKey | BDOVYFRIGUPCEE-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|