C15H15Cl2N3O3 — CID 18552098
N-(4-acetamido-2-chloro-5-hydroxyphenyl)-2-pyridin-1-ium-1-ylacetamide chloride (PubChem CID 18552098) has the molecular formula C15H15Cl2N3O3 and a molecular weight of 356.21 g/mol. Its IUPAC name is N-(4-acetamido-2-chloro-5-hydroxyphenyl)-2-pyridin-1-ium-1-ylacetamide chloride.
| Compound Name | N-(4-acetamido-2-chloro-5-hydroxyphenyl)-2-pyridin-1-ium-1-ylacetamide chloride |
|---|---|
| PubChem CID | 18552098 |
| Molecular Formula | C15H15Cl2N3O3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-(4-acetamido-2-chloro-5-hydroxyphenyl)-2-pyridin-1-ium-1-ylacetamide chloride |
| SMILES | CC(=O)Nc1cc(Cl)c(NC(=O)C[n+]2ccccc2)cc1O.[Cl-] |
| InChI | InChI=1S/C15H14ClN3O3.ClH/c1-10(20)17-13-7-11(16)12(8-14(13)21)18-15(22)9-19-5-3-2-4-6-19;/h2-8H,9H2,1H3,(H2-,17,18,20,21,22);1H |
| InChIKey | IALGIKCOXVHYPW-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 82.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|