C24H22Cl2N4O3 — CID 18172744
N-[1-hydroxy-8-[(2-pyridin-1-ium-1-ylacetyl)amino]naphthalen-2-yl]-2-pyridin-1-ium-1-ylacetamide dichloride (PubChem CID 18172744) has the molecular formula C24H22Cl2N4O3 and a molecular weight of 485.37 g/mol. Its IUPAC name is N-[1-hydroxy-8-[(2-pyridin-1-ium-1-ylacetyl)amino]naphthalen-2-yl]-2-pyridin-1-ium-1-ylacetamide dichloride.
| Compound Name | N-[1-hydroxy-8-[(2-pyridin-1-ium-1-ylacetyl)amino]naphthalen-2-yl]-2-pyridin-1-ium-1-ylacetamide dichloride |
|---|---|
| PubChem CID | 18172744 |
| Molecular Formula | C24H22Cl2N4O3 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-[1-hydroxy-8-[(2-pyridin-1-ium-1-ylacetyl)amino]naphthalen-2-yl]-2-pyridin-1-ium-1-ylacetamide dichloride |
| SMILES | O=C(C[n+]1ccccc1)Nc1ccc2cccc(NC(=O)C[n+]3ccccc3)c2c1O.[Cl-].[Cl-] |
| InChI | InChI=1S/C24H20N4O3.2ClH/c29-21(16-27-12-3-1-4-13-27)25-19-9-7-8-18-10-11-20(24(31)23(18)19)26-22(30)17-28-14-5-2-6-15-28;;/h1-15H,16-17H2,(H-2,25,26,29,30,31);2*1H |
| InChIKey | NDRNSPHZJWNEFF-UHFFFAOYSA-N |
| XLogP | -3.59 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|