C19H24N3O+ — CID 19993619
N-[2-(cyclohexylamino)phenyl]-2-pyridin-1-ium-1-ylacetamide (PubChem CID 19993619) has the molecular formula C19H24N3O+ and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)phenyl]-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-[2-(cyclohexylamino)phenyl]-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 19993619 |
| Molecular Formula | C19H24N3O+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-[2-(cyclohexylamino)phenyl]-2-pyridin-1-ium-1-ylacetamide |
| SMILES | O=C(C[n+]1ccccc1)Nc1ccccc1NC1CCCCC1 |
| InChI | InChI=1S/C19H23N3O/c23-19(15-22-13-7-2-8-14-22)21-18-12-6-5-11-17(18)20-16-9-3-1-4-10-16/h2,5-8,11-14,16,20H,1,3-4,9-10,15H2/p+1 |
| InChIKey | GRFUOBASGALFLS-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 45.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|