C15H18ClN2O+ — CID 126958731
N-(2,6-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide;hydrochloride (PubChem CID 126958731) has the molecular formula C15H18ClN2O+ and a molecular weight of 277.78 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide;hydrochloride.
| Compound Name | N-(2,6-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 126958731 |
| Molecular Formula | C15H18ClN2O+ |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide;hydrochloride |
| SMILES | Cc1cccc(C)c1NC(=O)C[n+]1ccccc1.Cl |
| InChI | InChI=1S/C15H16N2O.ClH/c1-12-7-6-8-13(2)15(12)16-14(18)11-17-9-4-3-5-10-17;/h3-10H,11H2,1-2H3;1H/p+1 |
| InChIKey | OJCYCQZJQFAKEP-UHFFFAOYSA-O |
| XLogP | 2.65 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|