C17H21BrN2O — CID 155102869
(3S)-N-(2,6-dimethylphenyl)-3-pyridin-1-ium-1-ylbutanamide bromide (PubChem CID 155102869) has the molecular formula C17H21BrN2O and a molecular weight of 349.27 g/mol. Its IUPAC name is (3S)-N-(2,6-dimethylphenyl)-3-pyridin-1-ium-1-ylbutanamide bromide.
| Compound Name | (3S)-N-(2,6-dimethylphenyl)-3-pyridin-1-ium-1-ylbutanamide bromide |
|---|---|
| PubChem CID | 155102869 |
| Molecular Formula | C17H21BrN2O |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (3S)-N-(2,6-dimethylphenyl)-3-pyridin-1-ium-1-ylbutanamide bromide |
| SMILES | Cc1cccc(C)c1NC(=O)C[C@H](C)[n+]1ccccc1.[Br-] |
| InChI | InChI=1S/C17H20N2O.BrH/c1-13-8-7-9-14(2)17(13)18-16(20)12-15(3)19-10-5-4-6-11-19;/h4-11,15H,12H2,1-3H3;1H/t15-;/m0./s1 |
| InChIKey | HRCMYSSHCZNOGK-RSAXXLAASA-N |
| XLogP | 0.18 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|