C18H23N3OP+ — CID 155692493
N-(2,6-dimethylphenyl)-2-imidazo[1,5-a]pyridin-2-ium-2-ylacetamide;methylphosphane (PubChem CID 155692493) has the molecular formula C18H23N3OP+ and a molecular weight of 328.38 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-imidazo[1,5-a]pyridin-2-ium-2-ylacetamide;methylphosphane.
| Compound Name | N-(2,6-dimethylphenyl)-2-imidazo[1,5-a]pyridin-2-ium-2-ylacetamide;methylphosphane |
|---|---|
| PubChem CID | 155692493 |
| Molecular Formula | C18H23N3OP+ |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-imidazo[1,5-a]pyridin-2-ium-2-ylacetamide;methylphosphane |
| SMILES | CP.Cc1cccc(C)c1NC(=O)C[n+]1cc2ccccn2c1 |
| InChI | InChI=1S/C17H17N3O.CH5P/c1-13-6-5-7-14(2)17(13)18-16(21)11-19-10-15-8-3-4-9-20(15)12-19;1-2/h3-10,12H,11H2,1-2H3;2H2,1H3/p+1 |
| InChIKey | OFOJOAAGXHLDRE-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|