C17H22N3O3S+ — CID 155615257
N-(2,6-dimethylphenyl)-2-[3-(dimethylsulfamoyl)pyridin-1-ium-1-yl]acetamide (PubChem CID 155615257) has the molecular formula C17H22N3O3S+ and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-(dimethylsulfamoyl)pyridin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-(dimethylsulfamoyl)pyridin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 155615257 |
| Molecular Formula | C17H22N3O3S+ |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-(dimethylsulfamoyl)pyridin-1-ium-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C[n+]1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-13-7-5-8-14(2)17(13)18-16(21)12-20-10-6-9-15(11-20)24(22,23)19(3)4/h5-11H,12H2,1-4H3/p+1 |
| InChIKey | XKXLWQAQAUQCMT-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|