C15H18N3O4S+ — CID 8751190
N-[3-(dimethylsulfamoyl)phenyl]-2-(3-hydroxypyridin-1-ium-1-yl)acetamide (PubChem CID 8751190) has the molecular formula C15H18N3O4S+ and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-(3-hydroxypyridin-1-ium-1-yl)acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(3-hydroxypyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8751190 |
| Molecular Formula | C15H18N3O4S+ |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(3-hydroxypyridin-1-ium-1-yl)acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)C[n+]2cccc(O)c2)c1 |
| InChI | InChI=1S/C15H17N3O4S/c1-17(2)23(21,22)14-7-3-5-12(9-14)16-15(20)11-18-8-4-6-13(19)10-18/h3-10H,11H2,1-2H3,(H-,16,19,20)/p+1 |
| InChIKey | UQTACUYZRDKZQL-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|