C16H21N4O3S+ — CID 8860799
N-[3-(dimethylsulfamoyl)phenyl]-2-(3-prop-2-enylimidazol-1-ium-1-yl)acetamide (PubChem CID 8860799) has the molecular formula C16H21N4O3S+ and a molecular weight of 349.44 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-(3-prop-2-enylimidazol-1-ium-1-yl)acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(3-prop-2-enylimidazol-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8860799 |
| Molecular Formula | C16H21N4O3S+ |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(3-prop-2-enylimidazol-1-ium-1-yl)acetamide |
| SMILES | C=CCn1cc[n+](CC(=O)Nc2cccc(S(=O)(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C16H20N4O3S/c1-4-8-19-9-10-20(13-19)12-16(21)17-14-6-5-7-15(11-14)24(22,23)18(2)3/h4-7,9-11,13H,1,8,12H2,2-3H3/p+1 |
| InChIKey | MDFQXCPATLEEGX-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|