C13H16N4O3S2 — CID 8716246
N-[3-(dimethylsulfamoyl)phenyl]-2-(2-imino-1,3-thiazol-3-yl)acetamide (PubChem CID 8716246) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-(2-imino-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(2-imino-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 8716246 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(2-imino-1,3-thiazol-3-yl)acetamide |
| SMILES | [H]/N=c1\sccn1CC(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H16N4O3S2/c1-16(2)22(19,20)11-5-3-4-10(8-11)15-12(18)9-17-6-7-21-13(17)14/h3-8,14H,9H2,1-2H3,(H,15,18)/b14-13- |
| InChIKey | ZFQDZARQUZPSJT-YPKPFQOOSA-N |
| XLogP | 0.92 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |