C17H20F3N2O2Y+ — CID 155692700
N-(2,6-dimethylphenyl)-2-[3-(trifluoromethyl)pyridin-1-ium-1-yl]acetamide;methanol;yttrium (PubChem CID 155692700) has the molecular formula C17H20F3N2O2Y+ and a molecular weight of 430.26 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-(trifluoromethyl)pyridin-1-ium-1-yl]acetamide;methanol;yttrium.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-(trifluoromethyl)pyridin-1-ium-1-yl]acetamide;methanol;yttrium |
|---|---|
| PubChem CID | 155692700 |
| Molecular Formula | C17H20F3N2O2Y+ |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-(trifluoromethyl)pyridin-1-ium-1-yl]acetamide;methanol;yttrium |
| SMILES | CO.Cc1cccc(C)c1NC(=O)C[n+]1cccc(C(F)(F)F)c1.[Y] |
| InChI | InChI=1S/C16H15F3N2O.CH4O.Y/c1-11-5-3-6-12(2)15(11)20-14(22)10-21-8-4-7-13(9-21)16(17,18)19;1-2;/h3-9H,10H2,1-2H3;2H,1H3;/p+1 |
| InChIKey | QKAOJNIVQQBREA-UHFFFAOYSA-O |
| XLogP | 2.85 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|