C14H12F3N2O2+ — CID 8751008
2-(3-hydroxypyridin-1-ium-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 8751008) has the molecular formula C14H12F3N2O2+ and a molecular weight of 297.26 g/mol. Its IUPAC name is 2-(3-hydroxypyridin-1-ium-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-hydroxypyridin-1-ium-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8751008 |
| Molecular Formula | C14H12F3N2O2+ |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-(3-hydroxypyridin-1-ium-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[n+]1cccc(O)c1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F3N2O2/c15-14(16,17)10-3-1-4-11(7-10)18-13(21)9-19-6-2-5-12(20)8-19/h1-8H,9H2,(H-,18,20,21)/p+1 |
| InChIKey | AHNAHXTYJKTTKK-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|