C23H23N2O2+ — CID 8859223
2-(4-benzoylpyridin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 8859223) has the molecular formula C23H23N2O2+ and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-(4-benzoylpyridin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(4-benzoylpyridin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 8859223 |
| Molecular Formula | C23H23N2O2+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-(4-benzoylpyridin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)C[n+]2ccc(C(=O)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H22N2O2/c1-16-13-17(2)22(18(3)14-16)24-21(26)15-25-11-9-20(10-12-25)23(27)19-7-5-4-6-8-19/h4-14H,15H2,1-3H3/p+1 |
| InChIKey | BDLOPZFBXZJIMZ-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|