C22H19FN3O3+ — CID 8858863
2-[[2-(4-benzoylpyridin-1-ium-1-yl)acetyl]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 8858863) has the molecular formula C22H19FN3O3+ and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[[2-(4-benzoylpyridin-1-ium-1-yl)acetyl]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[2-(4-benzoylpyridin-1-ium-1-yl)acetyl]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 8858863 |
| Molecular Formula | C22H19FN3O3+ |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[[2-(4-benzoylpyridin-1-ium-1-yl)acetyl]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(C[n+]1ccc(C(=O)c2ccccc2)cc1)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FN3O3/c23-18-6-8-19(9-7-18)25-20(27)14-24-21(28)15-26-12-10-17(11-13-26)22(29)16-4-2-1-3-5-16/h1-13H,14-15H2,(H-,24,25,27,28)/p+1 |
| InChIKey | JLEXBZMBGGLYOC-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|