C22H21N2O3+ — CID 3623487
N-(2-hydroxyethyl)-2-[4-(4-phenylbenzoyl)pyridin-1-ium-1-yl]acetamide (PubChem CID 3623487) has the molecular formula C22H21N2O3+ and a molecular weight of 361.42 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[4-(4-phenylbenzoyl)pyridin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[4-(4-phenylbenzoyl)pyridin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 3623487 |
| Molecular Formula | C22H21N2O3+ |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[4-(4-phenylbenzoyl)pyridin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[n+]1ccc(C(=O)c2ccc(-c3ccccc3)cc2)cc1)NCCO |
| InChI | InChI=1S/C22H20N2O3/c25-15-12-23-21(26)16-24-13-10-20(11-14-24)22(27)19-8-6-18(7-9-19)17-4-2-1-3-5-17/h1-11,13-14,25H,12,15-16H2/p+1 |
| InChIKey | IOAGFSCXHXMDKH-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 70.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|