C34H40N4O5+2 — CID 22889790
2-(4-phenylpyridin-1-ium-1-yl)-N-[2-[2-[2-[2-[[2-(4-phenylpyridin-1-ium-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 22889790) has the molecular formula C34H40N4O5+2 and a molecular weight of 584.72 g/mol. Its IUPAC name is 2-(4-phenylpyridin-1-ium-1-yl)-N-[2-[2-[2-[2-[[2-(4-phenylpyridin-1-ium-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-(4-phenylpyridin-1-ium-1-yl)-N-[2-[2-[2-[2-[[2-(4-phenylpyridin-1-ium-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 22889790 |
| Molecular Formula | C34H40N4O5+2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 2-(4-phenylpyridin-1-ium-1-yl)-N-[2-[2-[2-[2-[[2-(4-phenylpyridin-1-ium-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=C(C[n+]1ccc(-c2ccccc2)cc1)NCCOCCOCCOCCNC(=O)C[n+]1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H38N4O5/c39-33(27-37-17-11-31(12-18-37)29-7-3-1-4-8-29)35-15-21-41-23-25-43-26-24-42-22-16-36-34(40)28-38-19-13-32(14-20-38)30-9-5-2-6-10-30/h1-14,17-20H,15-16,21-28H2/p+2 |
| InChIKey | CECJZYODPRSHCI-UHFFFAOYSA-P |
| XLogP | 2.58 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|