C19H22ClN3O — CID 146048636
N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-2-pyridin-1-ium-1-ylacetamide chloride (PubChem CID 146048636) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-2-pyridin-1-ium-1-ylacetamide chloride.
| Compound Name | N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-2-pyridin-1-ium-1-ylacetamide chloride |
|---|---|
| PubChem CID | 146048636 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-2-pyridin-1-ium-1-ylacetamide chloride |
| SMILES | O=C(C[n+]1ccccc1)Nc1c2c(nc3c1CCC3)CCCC2.[Cl-] |
| InChI | InChI=1S/C19H21N3O.ClH/c23-18(13-22-11-4-1-5-12-22)21-19-14-7-2-3-9-16(14)20-17-10-6-8-15(17)19;/h1,4-5,11-12H,2-3,6-10,13H2;1H |
| InChIKey | MDEBKICJJOEFAT-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 45.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|