C25H30N4O7 — CID 3240011
2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)acetamide;oxalic acid (PubChem CID 3240011) has the molecular formula C25H30N4O7 and a molecular weight of 498.54 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)acetamide;oxalic acid.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)acetamide;oxalic acid |
|---|---|
| PubChem CID | 3240011 |
| Molecular Formula | C25H30N4O7 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)acetamide;oxalic acid |
| SMILES | O=C(CN1CCN(C(=O)c2ccco2)CC1)Nc1c2c(nc3c1CCC3)CCCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H28N4O3.C2H2O4/c28-21(15-26-10-12-27(13-11-26)23(29)20-9-4-14-30-20)25-22-16-5-1-2-7-18(16)24-19-8-3-6-17(19)22;3-1(4)2(5)6/h4,9,14H,1-3,5-8,10-13,15H2,(H,24,25,28);(H,3,4)(H,5,6) |
| InChIKey | VLEDNPCWYBSEIF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|