C18H21N3O5 — CID 44784201
N-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)-2-(dimethylamino)acetamide;oxalic acid (PubChem CID 44784201) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)-2-(dimethylamino)acetamide;oxalic acid.
| Compound Name | N-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)-2-(dimethylamino)acetamide;oxalic acid |
|---|---|
| PubChem CID | 44784201 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)-2-(dimethylamino)acetamide;oxalic acid |
| SMILES | CN(C)CC(=O)Nc1c2c(nc3ccccc13)CCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H19N3O.C2H2O4/c1-19(2)10-15(20)18-16-11-6-3-4-8-13(11)17-14-9-5-7-12(14)16;3-1(4)2(5)6/h3-4,6,8H,5,7,9-10H2,1-2H3,(H,17,18,20);(H,3,4)(H,5,6) |
| InChIKey | KKKNBQDZMMDNCL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|