C24H25N3O6 — CID 44657081
[2-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamino)-2-oxoethyl]-[2-(4-hydroxyphenyl)ethyl]azanium;2-hydroxy-2-oxoacetate (PubChem CID 44657081) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamino)-2-oxoethyl]-[2-(4-hydroxyphenyl)ethyl]azanium;2-hydroxy-2-oxoacetate.
| Compound Name | [2-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamino)-2-oxoethyl]-[2-(4-hydroxyphenyl)ethyl]azanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44657081 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [2-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamino)-2-oxoethyl]-[2-(4-hydroxyphenyl)ethyl]azanium;2-hydroxy-2-oxoacetate |
| SMILES | O=C(C[NH2+]CCc1ccc(O)cc1)Nc1c2c(nc3ccccc13)CCC2.O=C([O-])C(=O)O |
| InChI | InChI=1S/C22H23N3O2.C2H2O4/c26-16-10-8-15(9-11-16)12-13-23-14-21(27)25-22-17-4-1-2-6-19(17)24-20-7-3-5-18(20)22;3-1(4)2(5)6/h1-2,4,6,8-11,23,26H,3,5,7,12-14H2,(H,24,25,27);(H,3,4)(H,5,6) |
| InChIKey | HMICLUZFHIFHMI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 156.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|