C20H18N2O2 — CID 3678676
N-(4-hydroxyphenyl)-1,2,3,4-tetrahydroacridine-9-carboxamide (PubChem CID 3678676) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1,2,3,4-tetrahydroacridine-9-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-1,2,3,4-tetrahydroacridine-9-carboxamide |
|---|---|
| PubChem CID | 3678676 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(4-hydroxyphenyl)-1,2,3,4-tetrahydroacridine-9-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)c1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C20H18N2O2/c23-14-11-9-13(10-12-14)21-20(24)19-15-5-1-3-7-17(15)22-18-8-4-2-6-16(18)19/h1,3,5,7,9-12,23H,2,4,6,8H2,(H,21,24) |
| InChIKey | LYGAWNKCMWBWDQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|