C20H16F2N2O — CID 9247827
N-(2,4-difluorophenyl)-1,2,3,4-tetrahydroacridine-9-carboxamide (PubChem CID 9247827) has the molecular formula C20H16F2N2O and a molecular weight of 338.36 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1,2,3,4-tetrahydroacridine-9-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-1,2,3,4-tetrahydroacridine-9-carboxamide |
|---|---|
| PubChem CID | 9247827 |
| Molecular Formula | C20H16F2N2O |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-1,2,3,4-tetrahydroacridine-9-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C20H16F2N2O/c21-12-9-10-18(15(22)11-12)24-20(25)19-13-5-1-3-7-16(13)23-17-8-4-2-6-14(17)19/h1,3,5,7,9-11H,2,4,6,8H2,(H,24,25) |
| InChIKey | SBIBQNWUWMRYMB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |