C26H37N3O5 — CID 44659981
[2-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamino)-2-oxoethyl]-dipentylazanium;2-hydroxy-2-oxoacetate (PubChem CID 44659981) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamino)-2-oxoethyl]-dipentylazanium;2-hydroxy-2-oxoacetate.
| Compound Name | [2-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamino)-2-oxoethyl]-dipentylazanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44659981 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | [2-(2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamino)-2-oxoethyl]-dipentylazanium;2-hydroxy-2-oxoacetate |
| SMILES | CCCCC[NH+](CCCCC)CC(=O)Nc1c2c(nc3ccccc13)CCC2.O=C([O-])C(=O)O |
| InChI | InChI=1S/C24H35N3O.C2H2O4/c1-3-5-9-16-27(17-10-6-4-2)18-23(28)26-24-19-12-7-8-14-21(19)25-22-15-11-13-20(22)24;3-1(4)2(5)6/h7-8,12,14H,3-6,9-11,13,15-18H2,1-2H3,(H,25,26,28);(H,3,4)(H,5,6) |
| InChIKey | WNNGFKFBWUBSTD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|