C26H42N3O+ — CID 7300204
[2-[(3-ethyl-2-propylquinolin-4-yl)amino]-2-oxoethyl]-dipentylazanium (PubChem CID 7300204) has the molecular formula C26H42N3O+ and a molecular weight of 412.64 g/mol. Its IUPAC name is [2-[(3-ethyl-2-propylquinolin-4-yl)amino]-2-oxoethyl]-dipentylazanium.
| Compound Name | [2-[(3-ethyl-2-propylquinolin-4-yl)amino]-2-oxoethyl]-dipentylazanium |
|---|---|
| PubChem CID | 7300204 |
| Molecular Formula | C26H42N3O+ |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | [2-[(3-ethyl-2-propylquinolin-4-yl)amino]-2-oxoethyl]-dipentylazanium |
| SMILES | CCCCC[NH+](CCCCC)CC(=O)Nc1c(CC)c(CCC)nc2ccccc12 |
| InChI | InChI=1S/C26H41N3O/c1-5-9-13-18-29(19-14-10-6-2)20-25(30)28-26-21(8-4)23(15-7-3)27-24-17-12-11-16-22(24)26/h11-12,16-17H,5-10,13-15,18-20H2,1-4H3,(H,27,28,30)/p+1 |
| InChIKey | IRTWANIQVXCLHV-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|