About 9-butylacridine
9-butylacridine (PubChem CID 606127) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is 9-butylacridine.
Molecular Properties
| Compound Name | 9-butylacridine |
| PubChem CID | 606127 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 9-butylacridine |
| SMILES | CCCCc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C17H17N/c1-2-3-8-13-14-9-4-6-11-16(14)18-17-12-7-5-10-15(13)17/h4-7,9-12H,2-3,8H2,1H3 |
| InChIKey | KHUOVNYGHHFONO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-butylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butylacridine?
The IUPAC name of 9-butylacridine (CID 606127) is 9-butylacridine.
What is the SMILES notation for 9-butylacridine?
The canonical SMILES for 9-butylacridine is CCCCc1c2ccccc2nc2ccccc12.
What is the InChIKey of 9-butylacridine?
The InChIKey is KHUOVNYGHHFONO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c1-2-3-8-13-14-9-4-6-11-16(14)18-17-12-7-5-10-15(13)17/h4-7,9-12H,2-3,8H2,1H3.
What are the key properties of 9-butylacridine?
9-butylacridine has a molecular weight of 235.33 g/mol, XLogP of 4.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butylacridine is sourced from PubChem (CID 606127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).