About acridine;9-propylacridine
acridine;9-propylacridine (PubChem CID 146450775) has the molecular formula C29H24N2
and a molecular weight of 400.53 g/mol. Its IUPAC name is acridine;9-propylacridine.
Molecular Properties
| Compound Name | acridine;9-propylacridine |
| PubChem CID | 146450775 |
| Molecular Formula | C29H24N2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | acridine;9-propylacridine |
| SMILES | CCCc1c2ccccc2nc2ccccc12.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C16H15N.C13H9N/c1-2-7-12-13-8-3-5-10-15(13)17-16-11-6-4-9-14(12)16;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h3-6,8-11H,2,7H2,1H3;1-9H |
| InChIKey | IDEPVPOYFDMVKN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;9-propylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;9-propylacridine?
The IUPAC name of acridine;9-propylacridine (CID 146450775) is acridine;9-propylacridine.
What is the SMILES notation for acridine;9-propylacridine?
The canonical SMILES for acridine;9-propylacridine is CCCc1c2ccccc2nc2ccccc12.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;9-propylacridine?
The InChIKey is IDEPVPOYFDMVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N.C13H9N/c1-2-7-12-13-8-3-5-10-15(13)17-16-11-6-4-9-14(12)16;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h3-6,8-11H,2,7H2,1H3;1-9H.
What are the key properties of acridine;9-propylacridine?
acridine;9-propylacridine has a molecular weight of 400.53 g/mol, XLogP of 7.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;9-propylacridine is sourced from PubChem (CID 146450775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).