About 4-propylacridine
4-propylacridine (PubChem CID 609894) has the molecular formula C16H15N
and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-propylacridine.
Molecular Properties
| Compound Name | 4-propylacridine |
| PubChem CID | 609894 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-propylacridine |
| SMILES | CCCc1cccc2cc3ccccc3nc12 |
| InChI | InChI=1S/C16H15N/c1-2-6-12-8-5-9-14-11-13-7-3-4-10-15(13)17-16(12)14/h3-5,7-11H,2,6H2,1H3 |
| InChIKey | JSQXSKCAAQQVGQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-propylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylacridine?
The IUPAC name of 4-propylacridine (CID 609894) is 4-propylacridine.
What is the SMILES notation for 4-propylacridine?
The canonical SMILES for 4-propylacridine is CCCc1cccc2cc3ccccc3nc12.
What is the InChIKey of 4-propylacridine?
The InChIKey is JSQXSKCAAQQVGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N/c1-2-6-12-8-5-9-14-11-13-7-3-4-10-15(13)17-16(12)14/h3-5,7-11H,2,6H2,1H3.
What are the key properties of 4-propylacridine?
4-propylacridine has a molecular weight of 221.30 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylacridine is sourced from PubChem (CID 609894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).