C16H22N2 — CID 55223741
N-methyl-3,8-dipropylquinolin-2-amine (PubChem CID 55223741) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-methyl-3,8-dipropylquinolin-2-amine.
| Compound Name | N-methyl-3,8-dipropylquinolin-2-amine |
|---|---|
| PubChem CID | 55223741 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-methyl-3,8-dipropylquinolin-2-amine |
| SMILES | CCCc1cc2cccc(CCC)c2nc1NC |
| InChI | InChI=1S/C16H22N2/c1-4-7-12-9-6-10-13-11-14(8-5-2)16(17-3)18-15(12)13/h6,9-11H,4-5,7-8H2,1-3H3,(H,17,18) |
| InChIKey | YEMWNUNJHRIOLK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |