C13H13F3N2 — CID 55174798
5,7,8-trifluoro-N-methyl-3-propylquinolin-2-amine (PubChem CID 55174798) has the molecular formula C13H13F3N2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 5,7,8-trifluoro-N-methyl-3-propylquinolin-2-amine.
| Compound Name | 5,7,8-trifluoro-N-methyl-3-propylquinolin-2-amine |
|---|---|
| PubChem CID | 55174798 |
| Molecular Formula | C13H13F3N2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 5,7,8-trifluoro-N-methyl-3-propylquinolin-2-amine |
| SMILES | CCCc1cc2c(F)cc(F)c(F)c2nc1NC |
| InChI | InChI=1S/C13H13F3N2/c1-3-4-7-5-8-9(14)6-10(15)11(16)12(8)18-13(7)17-2/h5-6H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | QSZHGRJPLVYNJL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|